CAS 898784-91-3
:1-(3-iodophenyl)-2-(2-methoxyphenyl)ethanone
Description:
1-(3-Iodophenyl)-2-(2-methoxyphenyl)ethanone, with the CAS number 898784-91-3, is an organic compound characterized by its unique structure, which includes an ethanone functional group attached to two aromatic rings. The presence of the iodine atom on one of the phenyl groups contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of ketones, such as being a polar molecule, which can influence its solubility in various solvents. The methoxy group on the second phenyl ring may enhance its lipophilicity and affect its interaction with biological targets. Additionally, the compound may possess interesting photophysical properties due to the conjugation between the aromatic systems. Its iodine substituent could also play a role in applications related to medicinal chemistry, particularly in the development of pharmaceuticals or as a precursor in organic synthesis. Overall, the compound's structural features suggest potential utility in various chemical and biological applications, warranting further investigation into its properties and reactivity.
Formula:C15H13IO2
InChI:InChI=1/C15H13IO2/c1-18-15-8-3-2-5-12(15)10-14(17)11-6-4-7-13(16)9-11/h2-9H,10H2,1H3
SMILES:COc1ccccc1CC(=O)c1cccc(c1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.