CAS 898784-92-4
:heptyl 2-chloropyridine-4-carboxylate
Description:
Heptyl 2-chloropyridine-4-carboxylate is an organic compound characterized by its structure, which includes a heptyl group, a chlorinated pyridine ring, and a carboxylate functional group. The heptyl group contributes to its hydrophobic properties, while the 2-chloro substitution on the pyridine ring can influence its reactivity and interaction with biological systems. The carboxylate moiety enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or nucleophilic substitution. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, heptyl 2-chloropyridine-4-carboxylate represents a versatile structure with applications in various chemical fields.
Formula:C13H18ClNO2
InChI:InChI=1/C13H18ClNO2/c1-2-3-4-5-6-9-17-13(16)11-7-8-15-12(14)10-11/h7-8,10H,2-6,9H2,1H3
SMILES:CCCCCCCOC(=O)c1ccnc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.