CymitQuimica logo

CAS 898784-94-6

:

octyl 2-chloropyridine-4-carboxylate

Description:
Octyl 2-chloropyridine-4-carboxylate is an organic compound characterized by its pyridine ring, which features a chlorine substituent at the 2-position and a carboxylate group at the 4-position. The octyl group, a straight-chain alkyl group with eight carbon atoms, contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential reactivity due to the presence of the carboxylate group, which can participate in nucleophilic substitution reactions. Additionally, the chlorine atom can influence the compound's reactivity and stability, potentially affecting its interactions in biological systems. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C14H20ClNO2
InChI:InChI=1/C14H20ClNO2/c1-2-3-4-5-6-7-10-18-14(17)12-8-9-16-13(15)11-12/h8-9,11H,2-7,10H2,1H3
SMILES:CCCCCCCCOC(=O)c1ccnc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.