CAS 898785-12-1

(2-Chloro-4-pyridinyl)cyclopropylmethanone

Description:

(2-Chloro-4-pyridinyl)cyclopropylmethanone, identified by its CAS number 898785-12-1, is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a pyridine ring substituted with a chlorine atom. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the chloro substituent can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The cyclopropyl moiety adds strain and can enhance the compound's reactivity compared to more stable cyclic structures. In terms of applications, compounds like this are often explored in medicinal chemistry for their potential biological activities, including antimicrobial or anticancer properties. However, specific characteristics such as solubility, melting point, and boiling point would depend on the compound's interactions with solvents and its molecular weight. Overall, (2-Chloro-4-pyridinyl)cyclopropylmethanone represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₉H₈ClNO

InChI: InChI=1S/C9H8ClNO/c10-8-5-7(3-4-11-8)9(12)6-1-2-6/h3-6H,1-2H2

InChI key: InChIKey=HEEQRCHSVMWWLK-UHFFFAOYSA-N

SMILES: C(=O)(C1CC1)C=2C=C(Cl)N=CC2

Synonyms:

• (2-Chloro-4-pyridinyl)cyclopropylmethanone
• 2-Chloro-4-cyclopropanecarbonylpyridine
• Methanone, (2-chloro-4-pyridinyl)cyclopropyl-