CAS 898785-13-2

1,3-Dioxolane, 2-[(4-chloro-2-methylphenyl)methyl]-

Description:

1,3-Dioxolane, 2-[(4-chloro-2-methylphenyl)methyl]- is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms and three carbon atoms. The presence of the 4-chloro-2-methylphenyl group indicates that this compound has a substituted aromatic ring, contributing to its chemical reactivity and potential applications. This compound may exhibit properties typical of dioxolanes, such as being a polar solvent and having moderate stability under standard conditions. Its chlorinated aromatic substituent can enhance its biological activity and influence its interactions in various chemical environments. The compound is likely to be of interest in fields such as medicinal chemistry or materials science, where its unique structure may impart specific functional properties. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential applications.

Formula: C₁₁H₁₃ClO₂

InChI: InChI=1S/C11H13ClO2/c1-8-6-10(12)3-2-9(8)7-11-13-4-5-14-11/h2-3,6,11H,4-5,7H2,1H3

InChI key: InChIKey=TYZOLROABCYBKT-UHFFFAOYSA-N

SMILES: C(C1=C(C)C=C(Cl)C=C1)C2OCCO2

Synonyms:

• 1,3-Dioxolane, 2-[(4-chloro-2-methylphenyl)methyl]-

4-Chloro-2-methyl (1,3-dioxolan-2-ylmethyl)benzene

CAS: 898785-13-2

Formula: C₁₁H₁₃ClO₂

Purity: 97.0%

Molecular weight: 212.67

Ref: 10-F208253