CAS 898785-16-5
:2-[(4-chloro-3-methyl-phenyl)methyl]-1,3-dioxolane
Description:
2-[(4-chloro-3-methyl-phenyl)methyl]-1,3-dioxolane is an organic compound characterized by its unique structural features, including a dioxolane ring and a substituted phenyl group. The presence of the dioxolane moiety indicates that it contains two oxygen atoms within a five-membered ring, which contributes to its potential reactivity and solubility properties. The compound features a chlorinated aromatic ring, which can influence its electronic properties and interactions with biological systems. The methyl group on the phenyl ring adds to its steric profile, potentially affecting its binding affinity in various chemical reactions. This compound may exhibit interesting pharmacological properties due to its structural characteristics, making it a subject of interest in medicinal chemistry. Additionally, its CAS number, 898785-16-5, allows for easy identification and retrieval of information regarding its synthesis, safety data, and applications in research. Overall, the combination of functional groups and structural elements in this compound suggests a diverse range of chemical behavior and potential applications.
Formula:C11H13ClO2
InChI:InChI=1/C11H13ClO2/c1-8-6-9(2-3-10(8)12)7-11-13-4-5-14-11/h2-3,6,11H,4-5,7H2,1H3
SMILES:Cc1cc(ccc1Cl)CC1OCCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.