CymitQuimica logo

CAS 898785-22-3

:

2-[(5-Fluoro-2-methoxyphenyl)methyl]-1,3-dioxolane

Description:
2-[(5-Fluoro-2-methoxyphenyl)methyl]-1,3-dioxolane is a chemical compound characterized by its unique structure, which includes a dioxolane ring and a substituted phenyl group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical properties, potentially influencing its reactivity and biological activity. The dioxolane moiety is known for its stability and ability to participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to aromatic systems can enhance efficacy or selectivity. The compound's CAS number, 898785-22-3, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound, including its functional groups and ring structure, suggest a versatile nature that could be explored for various applications in chemical synthesis and medicinal chemistry.
Formula:C11H13FO3
InChI:InChI=1S/C11H13FO3/c1-13-10-3-2-9(12)6-8(10)7-11-14-4-5-15-11/h2-3,6,11H,4-5,7H2,1H3
InChI key:InChIKey=NYMQBLWQHXZHRK-UHFFFAOYSA-N
SMILES:C(C1=C(OC)C=CC(F)=C1)C2OCCO2
Synonyms:
  • 2-[(5-Fluoro-2-methoxyphenyl)methyl]-1,3-dioxolane
  • 1,3-Dioxolane, 2-[(5-fluoro-2-methoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.