CymitQuimica logo

CAS 898785-25-6

:

2-[(4-methoxy-2-methyl-phenyl)methyl]-1,3-dioxolane

Description:
2-[(4-methoxy-2-methyl-phenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which is a five-membered cyclic ether containing two oxygen atoms. The presence of the 4-methoxy-2-methylphenyl group indicates that the compound has a substituted aromatic ring, contributing to its overall stability and reactivity. This compound is likely to exhibit moderate polarity due to the methoxy group, which can engage in hydrogen bonding and influence solubility in various solvents. The dioxolane moiety can also participate in nucleophilic reactions, making it a potential candidate for various synthetic applications in organic chemistry. Additionally, the presence of the aromatic ring may impart unique electronic properties, affecting its behavior in chemical reactions. Overall, this compound's structure suggests it may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific biological activities or applications would require further investigation.
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-9-7-11(13-2)4-3-10(9)8-12-14-5-6-15-12/h3-4,7,12H,5-6,8H2,1-2H3
InChI key:InChIKey=WPIFCJDIENCHNY-UHFFFAOYSA-N
SMILES:Cc1cc(ccc1CC1OCCO1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.