CAS 898785-31-4

2-[(2-methoxy-5-methyl-phenyl)methyl]-1,3-dioxolane

Description:

2-[(2-methoxy-5-methyl-phenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered cyclic ether containing two oxygen atoms. This compound features a methoxy group and a methyl-substituted phenyl group, contributing to its unique chemical properties. The presence of the dioxolane moiety suggests potential applications in organic synthesis and as a solvent or intermediate in various chemical reactions. Its molecular structure indicates that it may exhibit moderate polarity, influencing its solubility in different solvents. Additionally, the presence of functional groups such as the methoxy and methyl groups can affect its reactivity and interactions with other molecules. The compound's CAS number, 898785-31-4, allows for easy identification in chemical databases and literature. Overall, 2-[(2-methoxy-5-methyl-phenyl)methyl]-1,3-dioxolane is a versatile compound with potential applications in pharmaceuticals and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c1-9-3-4-11(13-2)10(7-9)8-12-14-5-6-15-12/h3-4,7,12H,5-6,8H2,1-2H3

SMILES: Cc1ccc(c(c1)CC1OCCO1)OC

2-methoxy-5-methyl(1,3-dioxolan-2-ylmethyl)benzene

CAS: 898785-31-4

Formula: C₁₂H₁₆O₃

Purity: 97.0%

Molecular weight: 208.257

Ref: 10-F208259