CAS 898785-34-7

2-[(2,4,6-trimethylphenyl)methyl]-1,3-dioxolane

Description:

2-[(2,4,6-trimethylphenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. The presence of the 2,4,6-trimethylphenyl group indicates that the compound has a bulky aromatic substituent, contributing to its hydrophobic nature and potentially influencing its reactivity and solubility. This compound is likely to exhibit properties typical of dioxolanes, such as being a stable, cyclic ether that can participate in various chemical reactions, including nucleophilic attacks and ring-opening reactions under certain conditions. The presence of the trimethylphenyl group may also enhance its stability and alter its electronic properties. Additionally, due to its structural features, it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly regarding its potential toxicity and reactivity.

Formula: C₁₃H₁₈O₂

InChI: InChI=1/C13H18O2/c1-9-6-10(2)12(11(3)7-9)8-13-14-4-5-15-13/h6-7,13H,4-5,8H2,1-3H3

SMILES: Cc1cc(C)c(CC2OCCO2)c(C)c1