CAS 898785-38-1
:3-(2-ethylphenyl)cyclohexan-1-one
Description:
3-(2-Ethylphenyl)cyclohexan-1-one, with the CAS number 898785-38-1, is an organic compound characterized by its cyclohexanone structure substituted with a 2-ethylphenyl group. This compound typically exhibits a white to pale yellow solid appearance and has a moderate molecular weight. It is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the cyclohexanone moiety suggests that it may participate in reactions typical of ketones, such as nucleophilic additions. Additionally, the aromatic ethylphenyl substituent can influence the compound's reactivity and solubility properties, making it of interest in both industrial and research contexts. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the conditions and purity of the sample. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C14H18O
InChI:InChI=1/C14H18O/c1-2-11-6-3-4-9-14(11)12-7-5-8-13(15)10-12/h3-4,6,9,12H,2,5,7-8,10H2,1H3
SMILES:CCc1ccccc1C1CCCC(=O)C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.