CymitQuimica logo

CAS 898785-40-5

:

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-phenyl-1-butanone

Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-phenyl-1-butanone, with the CAS number 898785-40-5, is an organic compound characterized by its complex structure that includes a dioxane ring and a phenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid with a distinctive odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic characteristics. The presence of the dioxane moiety may impart stability and influence its reactivity, making it of interest in various chemical applications, including synthesis and as a potential intermediate in organic reactions. Additionally, its unique structure may contribute to specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential uses. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance.
Formula:C16H22O3
InChI:InChI=1S/C16H22O3/c1-16(2)11-18-15(19-12-16)10-6-9-14(17)13-7-4-3-5-8-13/h3-5,7-8,15H,6,9-12H2,1-2H3
InChI key:InChIKey=MKFZEQOBIXFPMX-UHFFFAOYSA-N
SMILES:C(CCCC1OCC(C)(C)CO1)(=O)C2=CC=CC=C2
Synonyms:
  • 4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-phenyl-1-butanone
  • 1-Butanone, 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.