CAS 898785-43-8

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-phenyl-1-pentanone

Description:

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-phenyl-1-pentanone, with the CAS number 898785-43-8, is an organic compound characterized by its complex structure that includes a dioxane ring and a ketone functional group. This compound typically exhibits properties associated with ketones, such as being a polar solvent and having a relatively high boiling point compared to non-polar compounds. The presence of the dioxane moiety contributes to its stability and solubility in various organic solvents. It may also display moderate reactivity, particularly in nucleophilic addition reactions due to the electrophilic nature of the carbonyl group. The phenyl group enhances its aromatic characteristics, potentially influencing its interactions with other molecules. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₇H₂₄O₃

InChI: InChI=1S/C17H24O3/c1-17(2)12-19-16(20-13-17)11-7-6-10-15(18)14-8-4-3-5-9-14/h3-5,8-9,16H,6-7,10-13H2,1-2H3

InChI key: InChIKey=JOCQUPARSLWUJU-UHFFFAOYSA-N

SMILES: C(CCCCC1OCC(C)(C)CO1)(=O)C2=CC=CC=C2

Synonyms:

• 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-phenyl-1-pentanone
• 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-phenyl-