CAS 898785-44-9

3-[(4-methoxyphenyl)methyl]cyclohexan-1-one

Description:

3-[(4-Methoxyphenyl)methyl]cyclohexan-1-one, identified by its CAS number 898785-44-9, is an organic compound characterized by its cyclohexanone structure substituted with a 4-methoxybenzyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and interactions. The compound may be of interest in various fields, including medicinal chemistry and materials science, due to its structural features that could contribute to specific pharmacological properties or applications in organic synthesis. Its reactivity is influenced by the carbonyl group, which can participate in nucleophilic addition reactions, while the aromatic ring may engage in electrophilic substitution. Overall, 3-[(4-methoxyphenyl)methyl]cyclohexan-1-one represents a versatile scaffold for further chemical modifications and investigations.

Formula: C₁₄H₁₈O₂

InChI: InChI=1/C14H18O2/c1-16-14-7-5-11(6-8-14)9-12-3-2-4-13(15)10-12/h5-8,12H,2-4,9-10H2,1H3

SMILES: COc1ccc(cc1)CC1CCCC(=O)C1

3-[(4-Methoxyphenyl)methyl]cyclohexanone

CAS: 898785-44-9

Formula: C₁₄H₁₈O₂

Purity: 97.0%

Molecular weight: 218.296

Ref: 10-F203866