CAS 898785-49-4
:3-(1,3-Dioxan-2-yl)-1-(3-iodophenyl)-1-propanone
Description:
3-(1,3-Dioxan-2-yl)-1-(3-iodophenyl)-1-propanone is an organic compound characterized by its unique structural features, including a dioxane ring and an iodophenyl group. The presence of the dioxane moiety contributes to its potential solubility in polar solvents, while the iodophenyl group may enhance its reactivity and influence its electronic properties. This compound typically exhibits a ketone functional group, which is known for its ability to participate in various chemical reactions, such as nucleophilic additions. The iodine atom in the structure can serve as a leaving group in substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound may possess specific biological activities, which could be explored in medicinal chemistry. Its molecular weight, boiling point, and melting point would depend on the specific conditions and purity of the sample. Overall, 3-(1,3-Dioxan-2-yl)-1-(3-iodophenyl)-1-propanone is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H15IO3
InChI:InChI=1S/C13H15IO3/c14-11-4-1-3-10(9-11)12(15)5-6-13-16-7-2-8-17-13/h1,3-4,9,13H,2,5-8H2
InChI key:InChIKey=ZVKKJNJAZQKZRB-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=CC(I)=CC=C2
Synonyms:- 1-Propanone, 3-(1,3-dioxan-2-yl)-1-(3-iodophenyl)-
- 3-(1,3-Dioxan-2-yl)-1-(3-iodophenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.