CAS 898785-50-7
:3,3-dimethyl-1-(m-tolyl)butan-1-one
Description:
3,3-Dimethyl-1-(m-tolyl)butan-1-one, with the CAS number 898785-50-7, is an organic compound belonging to the class of ketones. It features a butanone backbone with two methyl groups attached to the third carbon and a m-tolyl group (a toluene derivative) attached to the first carbon. This structure contributes to its unique physical and chemical properties. The compound is typically a colorless to pale yellow liquid with a characteristic odor, and it is soluble in organic solvents. Its molecular structure suggests it may exhibit moderate volatility and a relatively low boiling point compared to larger ketones. In terms of reactivity, it may participate in typical ketone reactions, such as nucleophilic addition and oxidation. Safety data indicates that, like many organic solvents, it should be handled with care, as it may pose health risks upon inhalation or skin contact. Overall, 3,3-dimethyl-1-(m-tolyl)butan-1-one is of interest in various chemical applications, including synthesis and as a potential intermediate in organic chemistry.
Formula:C13H18O
InChI:InChI=1/C13H18O/c1-10-6-5-7-11(8-10)12(14)9-13(2,3)4/h5-8H,9H2,1-4H3
SMILES:Cc1cccc(c1)C(=O)CC(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.