CAS 898785-51-8
:1-(2-Chloro-4-pyridinyl)-5-cyclohexyl-1-pentanone
Description:
1-(2-Chloro-4-pyridinyl)-5-cyclohexyl-1-pentanone, identified by its CAS number 898785-51-8, is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring substituted with a chlorine atom and a cyclohexyl group attached to a pentanone backbone. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the chloro substituent may influence its biological activity and interaction with other molecules, making it of interest in medicinal chemistry and drug development. Additionally, the cyclohexyl group can impart steric effects that may affect the compound's conformation and overall stability. As with many organic compounds, safety and handling precautions should be observed, as it may possess toxicological properties. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and uses.
Formula:C16H22ClNO
InChI:InChI=1S/C16H22ClNO/c17-16-12-14(10-11-18-16)15(19)9-5-4-8-13-6-2-1-3-7-13/h10-13H,1-9H2
InChI key:InChIKey=MYSDPGYEGDKSHL-UHFFFAOYSA-N
SMILES:C(CCCCC1CCCCC1)(=O)C=2C=C(Cl)N=CC2
Synonyms:- 1-Pentanone, 1-(2-chloro-4-pyridinyl)-5-cyclohexyl-
- 1-(2-Chloro-4-pyridinyl)-5-cyclohexyl-1-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.