CymitQuimica logo

CAS 898785-54-1

:

4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-iodophenyl)butan-1-one

Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-iodophenyl)butan-1-one, with the CAS number 898785-54-1, is a synthetic organic compound characterized by its complex molecular structure. It features a butanone backbone, which is a ketone, indicating the presence of a carbonyl group (C=O) within its structure. The compound also contains a dioxane ring, contributing to its cyclic nature and potentially influencing its reactivity and solubility. The presence of the iodine atom on the phenyl group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The dimethyl groups on the dioxane ring may provide steric hindrance, affecting the compound's interactions with other molecules. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Its stability, solubility, and reactivity would depend on the surrounding conditions and the presence of other functional groups.
Formula:C16H21IO3
InChI:InChI=1/C16H21IO3/c1-16(2)10-19-15(20-11-16)9-5-8-14(18)12-6-3-4-7-13(12)17/h3-4,6-7,15H,5,8-11H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2ccccc2I)OC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.