CAS 898785-58-5

4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-iodophenyl)butan-1-one

Description:

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-iodophenyl)butan-1-one, with the CAS number 898785-58-5, is an organic compound characterized by its complex structure that includes a dioxane ring and a butanone moiety. This compound features a 4-iodophenyl group, which contributes to its potential reactivity and applications in various chemical reactions. The presence of the dioxane ring suggests that it may exhibit unique solubility and stability properties, making it of interest in synthetic organic chemistry. The iodine atom in the phenyl group can serve as a leaving group in nucleophilic substitution reactions, enhancing its utility in the synthesis of more complex molecules. Additionally, the dimethyl substituents on the dioxane ring may influence the steric and electronic properties of the compound, potentially affecting its reactivity and interactions with biological systems. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.

Formula: C₁₆H₂₁IO₃

InChI: InChI=1/C16H21IO3/c1-16(2)10-19-15(20-11-16)5-3-4-14(18)12-6-8-13(17)9-7-12/h6-9,15H,3-5,10-11H2,1-2H3

SMILES: CC1(C)COC(CCCC(=O)c2ccc(cc2)I)OC1