CymitQuimica logo

CAS 898785-66-5

:

1-(2-Bromophenyl)-3-(1,3-dioxan-2-yl)-1-propanone

Description:
1-(2-Bromophenyl)-3-(1,3-dioxan-2-yl)-1-propanone, with the CAS number 898785-66-5, is an organic compound characterized by its unique structural features. It contains a bromophenyl group, which contributes to its potential reactivity and biological activity, as bromine is a halogen known for its electronegativity and ability to participate in various chemical reactions. The presence of a dioxane ring indicates that the compound has a cyclic ether structure, which can influence its solubility and stability. The ketone functional group (propanone) suggests that it may undergo typical reactions associated with carbonyl compounds, such as nucleophilic addition. This compound may exhibit interesting properties, including potential applications in medicinal chemistry or as an intermediate in organic synthesis. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine and the potential for reactivity.
Formula:C13H15BrO3
InChI:InChI=1S/C13H15BrO3/c14-11-5-2-1-4-10(11)12(15)6-7-13-16-8-3-9-17-13/h1-2,4-5,13H,3,6-9H2
InChI key:InChIKey=XFHFKXRMEMGARU-UHFFFAOYSA-N
SMILES:C(CCC1OCCCO1)(=O)C2=C(Br)C=CC=C2
Synonyms:
  • 1-(2-Bromophenyl)-3-(1,3-dioxan-2-yl)-1-propanone
  • 1-Propanone, 1-(2-bromophenyl)-3-(1,3-dioxan-2-yl)-
  • 2′-Bromo-3-(1,3-dioxan-2-yl)propiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.