CymitQuimica logo

CAS 898785-70-1

:

1-(2-bromophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one

Description:
1-(2-Bromophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, with the CAS number 898785-70-1, is an organic compound characterized by its complex structure that includes a bromophenyl group and a dioxane moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its reactivity and solubility. The presence of the bromine atom suggests potential for electrophilic substitution reactions, while the dioxane ring can contribute to the compound's stability and solubility in organic solvents. Additionally, the butanone functional group indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Overall, its characteristics, including molecular weight, melting point, and boiling point, would be determined through experimental methods, as they are influenced by the compound's specific interactions and functional groups.
Formula:C16H21BrO3
InChI:InChI=1/C16H21BrO3/c1-16(2)10-19-15(20-11-16)9-5-8-14(18)12-6-3-4-7-13(12)17/h3-4,6-7,15H,5,8-11H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2ccccc2Br)OC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.