CAS 898785-74-5

1-(4-bromophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one

Description:

1-(4-bromophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, with the CAS number 898785-74-5, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a dioxane moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the bromine atom enhances its electrophilic character, making it a candidate for further chemical modifications. The dioxane ring introduces a degree of rigidity and may influence the compound's interaction with biological systems, potentially affecting its pharmacological properties. As a ketone, it features a carbonyl group that can participate in various chemical reactions, including nucleophilic additions. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science, although specific biological activity and stability would require further investigation through empirical studies.

Formula: C₁₆H₂₁BrO₃

InChI: InChI=1/C16H21BrO3/c1-16(2)10-19-15(20-11-16)5-3-4-14(18)12-6-8-13(17)9-7-12/h6-9,15H,3-5,10-11H2,1-2H3

SMILES: CC1(C)COC(CCCC(=O)c2ccc(cc2)Br)OC1

4′-bromo-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone

CAS: 898785-74-5

Formula: C₁₆H₂₁BrO₃

Purity: 97.0%

Molecular weight: 341.245

Ref: 10-F208302