CymitQuimica logo

CAS 898785-77-8

:

methyl 5-(6-chloropyridine-3-carbonyl)furan-2-carboxylate

Description:
Methyl 5-(6-chloropyridine-3-carbonyl)furan-2-carboxylate is an organic compound characterized by its complex structure, which includes a furan ring and a chloropyridine moiety. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the chloropyridine ring introduces halogen substituents, which can influence the compound's electronic properties and biological activity. The furan ring, known for its aromaticity, adds to the stability and potential reactivity of the molecule. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, given the presence of chlorine and potential toxicity associated with similar compounds.
Formula:C12H8ClNO4
InChI:InChI=1/C12H8ClNO4/c1-17-12(16)9-4-3-8(18-9)11(15)7-2-5-10(13)14-6-7/h2-6H,1H3
SMILES:COC(=O)c1ccc(C(=O)c2ccc(Cl)nc2)o1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.