CymitQuimica logo

CAS 898785-79-0

:

methyl 5-(2-chloropyridine-3-carbonyl)furan-2-carboxylate

Description:
Methyl 5-(2-chloropyridine-3-carbonyl)furan-2-carboxylate is an organic compound characterized by its complex structure, which includes a furan ring, a carboxylate group, and a chloropyridine moiety. This compound typically exhibits properties common to esters, such as being a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic furan and aromatic components. The presence of the chloropyridine group may impart specific reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and the development of pharmaceuticals. Additionally, the compound may exhibit biological activity, which can be explored in drug discovery contexts. Its synthesis and handling require standard laboratory safety protocols, as with many organic compounds, to mitigate any potential hazards associated with its chemical properties.
Formula:C12H8ClNO4
InChI:InChI=1/C12H8ClNO4/c1-17-12(16)9-5-4-8(18-9)10(15)7-3-2-6-14-11(7)13/h2-6H,1H3
SMILES:COC(=O)c1ccc(C(=O)c2cccnc2Cl)o1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.