CAS 898785-80-3

1-(4-bromophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one

Description:

1-(4-bromophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one, with the CAS number 898785-80-3, is an organic compound characterized by its complex structure that includes a bromophenyl group and a dioxane moiety. This compound features a pentanone backbone, indicating the presence of a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The bromine atom on the phenyl ring enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The dioxane ring adds to the compound's stability and solubility in organic solvents. Overall, this substance may exhibit interesting biological activities and could be of interest in medicinal chemistry or material science. Its unique structural features suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation through empirical studies.

Formula: C₁₇H₂₃BrO₃

InChI: InChI=1/C17H23BrO3/c1-17(2)11-20-16(21-12-17)6-4-3-5-15(19)13-7-9-14(18)10-8-13/h7-10,16H,3-6,11-12H2,1-2H3

SMILES: CC1(C)COC(CCCCC(=O)c2ccc(cc2)Br)OC1

4′-bromo-5-(5,5-dimethyl-1,3-dioxan-2-yl)valerophenone

CAS: 898785-80-3

Formula: C₁₇H₂₃BrO₃

Purity: 97.0%

Molecular weight: 355.272

Ref: 10-F208305