CymitQuimica logo

CAS 898785-83-6

:

methyl 3-(2-methoxypyridine-3-carbonyl)benzoate

Description:
Methyl 3-(2-methoxypyridine-3-carbonyl)benzoate, identified by its CAS number 898785-83-6, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. This compound features a methoxy group attached to a pyridine ring, contributing to its aromatic properties and potential biological activity. The presence of the carbonyl group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Methyl 3-(2-methoxypyridine-3-carbonyl)benzoate is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure, while its polar functional groups may enhance solubility in polar solvents. This compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. Additionally, its structural features suggest that it could serve as a building block for synthesizing more complex molecules in organic synthesis. As with many organic compounds, safety data should be consulted for handling and usage.
Formula:C15H13NO4
InChI:InChI=1/C15H13NO4/c1-19-14-12(7-4-8-16-14)13(17)10-5-3-6-11(9-10)15(18)20-2/h3-9H,1-2H3
SMILES:COc1c(cccn1)C(=O)c1cccc(c1)C(=O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.