CAS 898785-85-8

Methyl 4-[(2-methoxy-3-pyridinyl)carbonyl]benzoate

Description:

Methyl 4-[(2-methoxy-3-pyridinyl)carbonyl]benzoate, identified by its CAS number 898785-85-8, is an organic compound characterized by its ester functional group and a pyridine ring. This compound features a methyl ester derived from benzoic acid, with a carbonyl group attached to a pyridine moiety, which contributes to its potential biological activity. The presence of the methoxy group on the pyridine ring enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Methyl 4-[(2-methoxy-3-pyridinyl)carbonyl]benzoate may exhibit various chemical properties, including reactivity towards nucleophiles due to the electrophilic nature of the carbonyl carbon. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often display significant biological activities. Additionally, the compound's stability, melting point, and solubility characteristics would be essential for its practical applications, although specific values would need to be referenced from experimental data.

Formula: C₁₅H₁₃NO₄

InChI: InChI=1S/C15H13NO4/c1-19-14-12(4-3-9-16-14)13(17)10-5-7-11(8-6-10)15(18)20-2/h3-9H,1-2H3

InChI key: InChIKey=NWYCGZTZJFOCKU-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)N=CC=C1)C2=CC=C(C(OC)=O)C=C2

Synonyms:

• Methyl 4-[(2-methoxy-3-pyridinyl)carbonyl]benzoate
• Benzoic acid, 4-[(2-methoxy-3-pyridinyl)carbonyl]-, methyl ester

Methyl 4-(2-methoxynicotinoyl)benzoate

CAS: 898785-85-8

Formula: C₁₅H₁₃NO₄

Purity: 97.0%

Molecular weight: 271.272

Ref: 10-F202736