CAS 898785-91-6

2-[2-(6-methoxy-3-pyridyl)-2-oxo-ethyl]benzonitrile

Description:

2-[2-(6-methoxy-3-pyridyl)-2-oxo-ethyl]benzonitrile, with the CAS number 898785-91-6, is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a pyridine ring. This compound features a methoxy group attached to the pyridine, contributing to its potential solubility and reactivity. The presence of the carbonyl group (2-oxo) indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. The nitrile functional group (benzonitrile) suggests that it may exhibit properties typical of nitriles, including potential toxicity and the ability to undergo hydrolysis. This compound may be of interest in medicinal chemistry due to its structural features, which could influence biological activity. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in research related to pharmaceuticals or agrochemicals. As with any chemical substance, proper handling and safety protocols should be observed due to potential hazards associated with its use.

Formula: C₁₅H₁₂N₂O₂

InChI: InChI=1/C15H12N2O2/c1-19-15-7-6-13(10-17-15)14(18)8-11-4-2-3-5-12(11)9-16/h2-7,10H,8H2,1H3

SMILES: COc1ccc(cn1)C(=O)Cc1ccccc1C#N

Synonyms:

• Benzonitrile, 2-[2-(6-methoxy-3-pyridinyl)-2-oxoethyl]-
• 2-METHOXY-5-(2-CYANOPHENYLACETYL)PYRIDINE

2-Methoxy-5-(2-cyanophenylacetyl)pyridine

CAS: 898785-91-6

Formula: C₁₅H₁₂N₂O₂

Purity: 97.0%

Molecular weight: 252.273

Ref: 10-F202739