CAS 898785-98-3
:3-(1,3-dioxan-2-yl)-1-(2-fluorophenyl)propan-1-one
Description:
3-(1,3-Dioxan-2-yl)-1-(2-fluorophenyl)propan-1-one, with the CAS number 898785-98-3, is an organic compound characterized by its unique structural features. It contains a propanone functional group, which is indicative of ketones, and incorporates a dioxane ring, contributing to its cyclic ether characteristics. The presence of a fluorophenyl group suggests that the compound may exhibit interesting electronic properties due to the electronegative fluorine atom, which can influence reactivity and stability. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular interactions. Its potential applications could span various fields, including pharmaceuticals and materials science, where such compounds are often explored for their biological activity or as intermediates in synthetic pathways. The specific properties, such as solubility, melting point, and boiling point, would need to be determined experimentally or sourced from reliable chemical databases for practical applications.
Formula:C13H15FO3
InChI:InChI=1/C13H15FO3/c14-11-5-2-1-4-10(11)12(15)6-7-13-16-8-3-9-17-13/h1-2,4-5,13H,3,6-9H2
SMILES:c1ccc(c(c1)C(=O)CCC1OCCCO1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.