CAS 898786-00-0
:3-(1,3-dioxan-2-yl)-1-(3-fluorophenyl)propan-1-one
Description:
3-(1,3-Dioxan-2-yl)-1-(3-fluorophenyl)propan-1-one is an organic compound characterized by its unique structural features, including a dioxane ring and a fluorophenyl group. The presence of the dioxane moiety suggests that it may exhibit properties typical of cyclic ethers, such as moderate polarity and potential solubility in polar solvents. The fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity, which may affect its biological activity. This compound is likely to be a ketone, as indicated by the "propan-1-one" designation, which implies the presence of a carbonyl group (C=O) that can participate in various chemical reactions, including nucleophilic additions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the dioxane and fluorinated aromatic components, which can contribute to the compound's pharmacokinetic and pharmacodynamic properties.
Formula:C13H15FO3
InChI:InChI=1/C13H15FO3/c14-11-4-1-3-10(9-11)12(15)5-6-13-16-7-2-8-17-13/h1,3-4,9,13H,2,5-8H2
SMILES:c1cc(cc(c1)F)C(=O)CCC1OCCCO1
Synonyms:- 1-Propanone, 3-(1,3-Dioxan-2-Yl)-1-(3-Fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.