CAS 898786-05-5

Methyl 3-[(6-methoxy-3-pyridinyl)carbonyl]benzoate

Description:

Methyl 3-[(6-methoxy-3-pyridinyl)carbonyl]benzoate, identified by its CAS number 898786-05-5, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. This compound features a methoxy group attached to a pyridine ring, contributing to its potential biological activity and solubility properties. The presence of the carbonyl group linked to the pyridine enhances its reactivity and may influence its interactions in various chemical environments. Methyl 3-[(6-methoxy-3-pyridinyl)carbonyl]benzoate is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups present. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, where modifications to the pyridine and benzoate moieties can lead to compounds with specific biological activities. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₅H₁₃NO₄

InChI: InChI=1S/C15H13NO4/c1-19-13-7-6-12(9-16-13)14(17)10-4-3-5-11(8-10)15(18)20-2/h3-9H,1-2H3

InChI key: InChIKey=ZQEJQCKWNUWZTI-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(OC)=O)=CC=C1)C=2C=CC(OC)=NC2

Synonyms:

• Benzoic acid, 3-[(6-methoxy-3-pyridinyl)carbonyl]-, methyl ester
• Methyl 3-[(6-methoxy-3-pyridinyl)carbonyl]benzoate

Methyl 3-(6-methoxynicotinoyl)benzoate

CAS: 898786-05-5

Formula: C₁₅H₁₃NO₄

Purity: 97.0%

Molecular weight: 271.272

Ref: 10-F202747