CymitQuimica logo

CAS 898786-08-8

:

Methyl 4-[(6-methoxy-3-pyridinyl)carbonyl]benzoate

Description:
Methyl 4-[(6-methoxy-3-pyridinyl)carbonyl]benzoate, with the CAS number 898786-08-8, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. This compound features a methoxy group attached to a pyridine ring, contributing to its potential biological activity and solubility properties. The presence of the carbonyl group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Methyl 4-[(6-methoxy-3-pyridinyl)carbonyl]benzoate is likely to exhibit moderate polarity due to the combination of aromatic and heterocyclic structures, which can influence its interactions in biological systems. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature.
Formula:C15H13NO4
InChI:InChI=1/C15H13NO4/c1-19-13-8-7-12(9-16-13)14(17)10-3-5-11(6-4-10)15(18)20-2/h3-9H,1-2H3
InChI key:InChIKey=GMTSPHKWPRLGDX-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(OC)=O)C=C1)C=2C=CC(OC)=NC2
Synonyms:
  • Benzoic acid, 4-[(6-methoxy-3-pyridinyl)carbonyl]-, methyl ester
  • Methyl 4-[(6-methoxy-3-pyridinyl)carbonyl]benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.