CAS 898786-10-2
:7-chloro-1-[4-(trifluoromethoxy)phenyl]heptan-1-one
Description:
7-Chloro-1-[4-(trifluoromethoxy)phenyl]heptan-1-one, with the CAS number 898786-10-2, is a synthetic organic compound characterized by its complex structure, which includes a heptanone backbone, a chloro substituent, and a trifluoromethoxy group attached to a phenyl ring. This compound typically exhibits properties associated with both halogenated and fluorinated organic molecules, such as increased lipophilicity and potential bioactivity. The presence of the trifluoromethoxy group can enhance the compound's stability and influence its reactivity, making it of interest in medicinal chemistry and material science. Additionally, the chloro group may impart specific electronic effects that can affect the compound's interaction with biological targets. As a result, this compound may be investigated for its potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed studies on its physical and chemical properties, such as solubility, melting point, and reactivity, would be necessary to fully understand its behavior in various environments.
Formula:C14H16ClF3O2
InChI:InChI=1/C14H16ClF3O2/c15-10-4-2-1-3-5-13(19)11-6-8-12(9-7-11)20-14(16,17)18/h6-9H,1-5,10H2
SMILES:C(CCCCl)CCC(=O)c1ccc(cc1)OC(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.