CAS 898786-12-4
:5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-fluorophenyl)pentan-1-one
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-fluorophenyl)pentan-1-one is an organic compound characterized by its complex structure, which includes a pentanone backbone, a dioxane ring, and a fluorophenyl substituent. The presence of the dioxane moiety contributes to its potential solubility in organic solvents, while the fluorophenyl group may enhance its biological activity and lipophilicity. This compound is likely to exhibit a range of chemical properties, including reactivity due to the carbonyl group in the ketone functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the dioxane and phenyl groups can influence biological interactions. Additionally, the presence of the fluorine atom may impart unique electronic properties, affecting the compound's reactivity and stability. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C17H23FO3
InChI:InChI=1/C17H23FO3/c1-17(2)11-20-16(21-12-17)10-6-5-9-15(19)13-7-3-4-8-14(13)18/h3-4,7-8,16H,5-6,9-12H2,1-2H3
SMILES:CC1(C)COC(CCCCC(=O)c2ccccc2F)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.