CAS 898786-13-5

6-chloro-1-(2,4-dichlorophenyl)hexan-1-one

Description:

6-Chloro-1-(2,4-dichlorophenyl)hexan-1-one is an organic compound characterized by its complex structure, which includes a hexanone backbone substituted with a chloro group and a dichlorophenyl moiety. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. The presence of chlorine atoms enhances its reactivity and may influence its solubility in various solvents. It is likely to be a solid at room temperature, with a specific melting point and boiling point that would depend on its molecular interactions. The compound may have applications in pharmaceuticals or agrochemicals, given the presence of the dichlorophenyl group, which is often associated with bioactive compounds. Safety data sheets would indicate potential hazards, including toxicity and environmental impact, necessitating careful handling and disposal. Overall, 6-chloro-1-(2,4-dichlorophenyl)hexan-1-one is a compound of interest in chemical research and development.

Formula: C₁₂H₁₃Cl₃O

InChI: InChI=1/C12H13Cl3O/c13-7-3-1-2-4-12(16)10-6-5-9(14)8-11(10)15/h5-6,8H,1-4,7H2

SMILES: C(CCC(=O)c1ccc(cc1Cl)Cl)CCCl