CymitQuimica logo

CAS 898786-16-8

:

7-chloro-1-(2,4-dichlorophenyl)heptan-1-one

Description:
7-Chloro-1-(2,4-dichlorophenyl)heptan-1-one is an organic compound characterized by its complex structure, which includes a heptan backbone, a ketone functional group, and multiple chlorine substituents. The presence of the ketone group indicates that it has a carbonyl functional group (C=O), which typically contributes to the compound's reactivity and potential applications in organic synthesis. The chlorine atoms, located at the 7-position and on the phenyl ring, can influence the compound's physical properties, such as solubility and boiling point, as well as its biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the presence of multiple halogen atoms can enhance lipophilicity, potentially affecting its interaction with biological membranes. Overall, 7-chloro-1-(2,4-dichlorophenyl)heptan-1-one is a halogenated ketone that may have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H15Cl3O
InChI:InChI=1/C13H15Cl3O/c14-8-4-2-1-3-5-13(17)11-7-6-10(15)9-12(11)16/h6-7,9H,1-5,8H2
SMILES:C(CCCCl)CCC(=O)c1ccc(cc1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.