CAS 898786-20-4

Methyl 5-[(6-methoxy-3-pyridinyl)carbonyl]-2-thiophenecarboxylate

Description:

Methyl 5-[(6-methoxy-3-pyridinyl)carbonyl]-2-thiophenecarboxylate, identified by its CAS number 898786-20-4, is an organic compound characterized by its complex structure that includes a thiophene ring, a pyridine moiety, and an ester functional group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The methoxy group on the pyridine ring can influence its electronic properties, potentially enhancing its reactivity or interaction with biological targets. The thiophene ring contributes to the compound's stability and may also impart unique optical or electronic characteristics. Methyl esters like this compound are often used in medicinal chemistry and can serve as intermediates in the synthesis of more complex molecules. Overall, the compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activity would require further investigation.

Formula: C₁₃H₁₁NO₄S

InChI: InChI=1S/C13H11NO4S/c1-17-11-6-3-8(7-14-11)12(15)9-4-5-10(19-9)13(16)18-2/h3-7H,1-2H3

InChI key: InChIKey=QGOXNCLQAOAKPK-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(C(OC)=O)=CC1)C=2C=CC(OC)=NC2

Synonyms:

• Methyl 5-[(6-methoxy-3-pyridinyl)carbonyl]-2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 5-[(6-methoxy-3-pyridinyl)carbonyl]-, methyl ester

Methyl 5-(6-methoxynicotinoyl) thiophene-2-carboxylate

CAS: 898786-20-4

Formula: C₁₃H₁₁NO₄S

Purity: 97.0%

Molecular weight: 277.29

Ref: 10-F202753