CymitQuimica logo

CAS 898786-22-6

:

4-(7-chloroheptanoyl)benzonitrile

Description:
4-(7-Chloroheptanoyl)benzonitrile, identified by its CAS number 898786-22-6, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a 7-chloroheptanoyl group. This structure suggests that it possesses both aromatic and aliphatic characteristics, contributing to its chemical properties. The chloro group introduces a halogen, which can influence the compound's reactivity and polarity. The heptanoyl chain adds hydrophobic characteristics, potentially affecting solubility in various solvents. As a nitrile, it features a cyano group (-C≡N), which can participate in various chemical reactions, including nucleophilic additions and polymerization processes. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for practical applications. Overall, 4-(7-chloroheptanoyl)benzonitrile represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C14H16ClNO
InChI:InChI=1/C14H16ClNO/c15-10-4-2-1-3-5-14(17)13-8-6-12(11-16)7-9-13/h6-9H,1-5,10H2
SMILES:C(CCCCl)CCC(=O)c1ccc(cc1)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.