CAS 898786-23-7
:Methyl 5-[(2-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate
Description:
Methyl 5-[(2-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate, identified by its CAS number 898786-23-7, is an organic compound characterized by its unique structural features, which include a furan ring and a pyridine moiety. This compound typically exhibits properties associated with both furan and pyridine derivatives, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like esters and carbonyls. The methoxy group contributes to its polarity, influencing its solubility and interaction with biological systems. Methyl 5-[(2-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, this compound represents a class of heterocyclic compounds that may have applications in pharmaceuticals or agrochemicals, depending on its specific biological properties.
Formula:C13H11NO5
InChI:InChI=1S/C13H11NO5/c1-17-12-8(4-3-7-14-12)11(15)9-5-6-10(19-9)13(16)18-2/h3-7H,1-2H3
InChI key:InChIKey=XLNILAUXNZNFRQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)N=CC=C1)C=2OC(C(OC)=O)=CC2
Synonyms:- 2-Furancarboxylic acid, 5-[(2-methoxy-3-pyridinyl)carbonyl]-, methyl ester
- Methyl 5-[(2-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.