CAS 898786-24-8: 3-(1,3-dioxan-2-yl)-1-(4-nitrophenyl)propan-1-one

Description:3-(1,3-Dioxan-2-yl)-1-(4-nitrophenyl)propan-1-one, with the CAS number 898786-24-8, is an organic compound characterized by its unique structural features. It contains a propanone functional group, which is a ketone, and is substituted with a 4-nitrophenyl group, contributing to its potential reactivity and biological activity. The presence of a 1,3-dioxane ring adds to its stability and solubility properties, making it a versatile compound in organic synthesis. This compound may exhibit interesting pharmacological properties due to the nitro group, which can influence its electronic characteristics and interactions with biological targets. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-(1,3-dioxan-2-yl)-1-(4-nitrophenyl)propan-1-one represents a class of compounds that could be of interest in various chemical and pharmaceutical research fields.

Formula:C₁₃H₁₅NO₅

InChI:InChI=1S/C13H15NO5/c15-12(6-7-13-18-8-1-9-19-13)10-2-4-11(5-3-10)14(16)17/h2-5,13H,1,6-9H2

InChI key:InChIKey=BUXYMCQTJRUEAI-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(C=C1)N(=O)=O)CCC2OCCCO2