CAS 898786-25-9
:5-chloro-1-[3-(trifluoromethoxy)phenyl]pentan-1-one
Description:
5-Chloro-1-[3-(trifluoromethoxy)phenyl]pentan-1-one is an organic compound characterized by its complex structure, which includes a pentanone backbone substituted with a chloro group and a trifluoromethoxy phenyl group. The presence of the chloro substituent introduces a halogen, which can influence the compound's reactivity and polarity. The trifluoromethoxy group, consisting of a phenyl ring attached to a -O-CF3 moiety, imparts significant electron-withdrawing properties, enhancing the compound's lipophilicity and potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties due to its unique functional groups, making it a candidate for research in medicinal chemistry. Additionally, its molecular structure suggests potential applications in agrochemicals or as a synthetic intermediate in organic synthesis. The presence of fluorine atoms typically enhances stability and alters the compound's interaction with biological systems, which is a key consideration in drug design and development. Overall, 5-chloro-1-[3-(trifluoromethoxy)phenyl]pentan-1-one represents a versatile compound with potential utility in various chemical applications.
Formula:C12H12ClF3O2
InChI:InChI=1/C12H12ClF3O2/c13-7-2-1-6-11(17)9-4-3-5-10(8-9)18-12(14,15)16/h3-5,8H,1-2,6-7H2
SMILES:C(CCCl)CC(=O)c1cccc(c1)OC(F)(F)F
Synonyms:- 1-Pentanone, 5-chloro-1-[3-(trifluoromethoxy)phenyl]-
- 5-CHLORO-1-OXO-1-(3-TRIFLUOROMETHOXYPHENYL)PENTANE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.