CAS 898786-26-0

Methyl 5-[(6-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate

Description:

Methyl 5-[(6-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate, identified by its CAS number 898786-26-0, is an organic compound characterized by its furan and pyridine moieties. This compound features a furan ring substituted with a carboxylate group and a carbonyl group linked to a methoxy-substituted pyridine. The presence of the methoxy group enhances its solubility and may influence its biological activity. Methyl esters, such as this compound, are often used in various chemical syntheses and can exhibit diverse pharmacological properties, making them of interest in medicinal chemistry. The structure suggests potential applications in drug development, particularly due to the presence of the pyridine ring, which is known for its role in biological systems. Additionally, the compound's unique functional groups may contribute to its reactivity and interaction with biological targets. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and potential therapeutic applications.

Formula: C₁₃H₁₁NO₅

InChI: InChI=1S/C13H11NO5/c1-17-11-6-3-8(7-14-11)12(15)9-4-5-10(19-9)13(16)18-2/h3-7H,1-2H3

InChI key: InChIKey=NFUPBZQNOFQDRA-UHFFFAOYSA-N

SMILES: C(=O)(C=1OC(C(OC)=O)=CC1)C=2C=CC(OC)=NC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(6-methoxy-3-pyridinyl)carbonyl]-, methyl ester
• Methyl 5-[(6-methoxy-3-pyridinyl)carbonyl]-2-furancarboxylate

Methyl 5-(6-methoxynicotinoyl)-2- furanoate

CAS: 898786-26-0

Formula: C₁₃H₁₁NO₅

Purity: 97.0%

Molecular weight: 261.233

Ref: 10-F202755