CAS 898786-29-3

2-Furanyl(2-methoxy-3-pyridinyl)methanone

Description:

2-Furanyl(2-methoxy-3-pyridinyl)methanone, identified by its CAS number 898786-29-3, is an organic compound characterized by its unique structural features, which include a furan ring and a pyridine moiety. This compound typically exhibits a molecular structure that allows for various interactions due to the presence of both heterocyclic rings. The furan ring contributes to its aromaticity and potential reactivity, while the pyridine ring can participate in hydrogen bonding and coordination with metal ions. The methoxy group enhances its solubility in organic solvents and may influence its electronic properties. In terms of physical properties, compounds of this nature often display moderate to high melting points and can be soluble in polar and non-polar solvents, depending on their functional groups. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Overall, 2-Furanyl(2-methoxy-3-pyridinyl)methanone represents a versatile structure with potential applications in various chemical and pharmaceutical fields.

Formula: C₁₁H₉NO₃

InChI: InChI=1S/C11H9NO3/c1-14-11-8(4-2-6-12-11)10(13)9-5-3-7-15-9/h2-7H,1H3

InChI key: InChIKey=NBBLJIMBHUNLKH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)N=CC=C1)C2=CC=CO2

Synonyms:

• Methanone, 2-furanyl(2-methoxy-3-pyridinyl)-
• 2-Furanyl(2-methoxy-3-pyridinyl)methanone