CAS 898786-31-7
:7-chloro-1-[3-(trifluoromethoxy)phenyl]heptan-1-one
Description:
7-Chloro-1-[3-(trifluoromethoxy)phenyl]heptan-1-one is a synthetic organic compound characterized by its complex structure, which includes a heptanone backbone, a chloro substituent, and a trifluoromethoxy group attached to a phenyl ring. This compound typically exhibits properties associated with halogenated organic molecules, such as increased lipophilicity and potential bioactivity. The presence of the trifluoromethoxy group can enhance the compound's stability and influence its reactivity, making it of interest in medicinal chemistry and material science. The chloro group may also impart specific electronic properties, affecting the compound's interaction with biological targets. As a heptanone, it contains a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Overall, this compound's unique functional groups and structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activity and toxicity profiles would require further investigation.
Formula:C14H16ClF3O2
InChI:InChI=1/C14H16ClF3O2/c15-9-4-2-1-3-8-13(19)11-6-5-7-12(10-11)20-14(16,17)18/h5-7,10H,1-4,8-9H2
SMILES:C(CCCCl)CCC(=O)c1cccc(c1)OC(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.