CAS 898786-35-1

[2-(2-chloropyridine-3-carbonyl)phenyl] acetate

Description:

[2-(2-chloropyridine-3-carbonyl)phenyl] acetate, identified by its CAS number 898786-35-1, is an organic compound characterized by its complex structure, which includes a phenyl ring, an acetate group, and a chloropyridine moiety. This compound typically exhibits a moderate to high degree of lipophilicity due to the presence of aromatic rings, which can influence its solubility in organic solvents. The chloropyridine group introduces both electron-withdrawing characteristics and potential for hydrogen bonding, which can affect its reactivity and interactions in biological systems. The acetate functional group contributes to its ester characteristics, making it susceptible to hydrolysis under certain conditions. This compound may be of interest in medicinal chemistry and drug development, particularly for its potential biological activity, which could be influenced by the presence of the chloropyridine and phenyl groups. Overall, its unique structural features suggest a range of possible applications in pharmaceuticals or agrochemicals, pending further investigation into its specific properties and activities.

Formula: C₁₄H₁₀ClNO₃

InChI: InChI=1/C14H10ClNO3/c1-9(17)19-12-7-3-2-5-10(12)13(18)11-6-4-8-16-14(11)15/h2-8H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1cccnc1Cl

3-(2-Acetoxybenzoyl)-2-chloropyridine

CAS: 898786-35-1

Formula: C₁₄H₁₀ClNO₃

Purity: 90.0%

Molecular weight: 275.69

Ref: 10-F202758