CAS 898786-37-3
:7-chloro-1-(2-methoxyphenyl)heptan-1-one
Description:
7-Chloro-1-(2-methoxyphenyl)heptan-1-one is an organic compound characterized by its unique structure, which includes a heptan backbone, a ketone functional group, and a chloro substituent at the seventh carbon. The presence of a methoxyphenyl group at the first carbon adds to its complexity and may influence its chemical reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the ketone and methoxy groups, which can engage in hydrogen bonding and dipole interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the presence of halogens and aromatic systems often contributes to biological activity. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H19ClO2
InChI:InChI=1/C14H19ClO2/c1-17-14-10-6-5-8-12(14)13(16)9-4-2-3-7-11-15/h5-6,8,10H,2-4,7,9,11H2,1H3
InChI key:InChIKey=JVLPMYNLTMKGIY-UHFFFAOYSA-N
SMILES:C(CCCCCCCl)(=O)C1=C(OC)C=CC=C1
Synonyms:- 1-Heptanone, 7-chloro-1-(2-methoxyphenyl)-
- 7-Chloro-1-(2-methoxyphenyl)-1-heptanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.