CymitQuimica logo

CAS 898786-38-4

:

[3-(2-chloropyridine-3-carbonyl)phenyl] acetate

Description:
[3-(2-Chloropyridine-3-carbonyl)phenyl] acetate, with the CAS number 898786-38-4, is an organic compound characterized by its complex structure, which includes a phenyl ring, an acetate group, and a chloropyridine moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloropyridine group, which can participate in various chemical reactions. The chloropyridine component may impart specific biological activities, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active molecules. Additionally, the presence of the acetate group may influence its stability and reactivity, affecting how it interacts with other chemical species. Overall, [3-(2-chloropyridine-3-carbonyl)phenyl] acetate is a compound with unique characteristics that can be explored for various chemical and biological applications.
Formula:C14H10ClNO3
InChI:InChI=1/C14H10ClNO3/c1-9(17)19-11-5-2-4-10(8-11)13(18)12-6-3-7-16-14(12)15/h2-8H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1cccnc1Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.