CymitQuimica logo

CAS 898786-41-9

:

[4-(2-chloropyridine-3-carbonyl)phenyl] acetate

Description:
[4-(2-Chloropyridine-3-carbonyl)phenyl] acetate, with the CAS number 898786-41-9, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with an acetate group and a chloropyridine moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl and halogen functional groups. The chloropyridine component may impart specific biological activity or influence the compound's interaction with other molecules, making it of interest in medicinal chemistry and drug development. Its synthesis often involves acylation reactions, and it may be used as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the chlorine atom can also affect the compound's electronic properties and stability. Overall, [4-(2-chloropyridine-3-carbonyl)phenyl] acetate is a versatile compound with potential applications in various chemical and pharmaceutical contexts.
Formula:C14H10ClNO3
InChI:InChI=1/C14H10ClNO3/c1-9(17)19-11-6-4-10(5-7-11)13(18)12-3-2-8-16-14(12)15/h2-8H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1cccnc1Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.