CAS 898786-44-2

[2-(6-chloropyridine-3-carbonyl)phenyl] acetate

Description:

[2-(6-chloropyridine-3-carbonyl)phenyl] acetate, with the CAS number 898786-44-2, is an organic compound characterized by its complex structure that includes a phenyl ring, an acetate group, and a chloropyridine moiety. The presence of the chloropyridine ring introduces both electron-withdrawing and steric effects, which can influence the compound's reactivity and solubility. This substance is likely to exhibit moderate polarity due to the combination of aromatic and polar functional groups. It may participate in various chemical reactions, including acylation and nucleophilic substitutions, owing to the reactive carbonyl group. Additionally, the chlorine atom can affect the compound's biological activity, potentially enhancing its interaction with biological targets. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, [2-(6-chloropyridine-3-carbonyl)phenyl] acetate is of interest in medicinal chemistry and material science for its potential applications.

Formula: C₁₄H₁₀ClNO₃

InChI: InChI=1/C14H10ClNO3/c1-9(17)19-12-5-3-2-4-11(12)14(18)10-6-7-13(15)16-8-10/h2-8H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1ccc(Cl)nc1