CymitQuimica logo

CAS 898786-46-4

:

7-Chloro-1-(4-methoxyphenyl)-1-heptanone

Description:
7-Chloro-1-(4-methoxyphenyl)-1-heptanone, with the CAS number 898786-46-4, is an organic compound characterized by its ketone functional group and a chloro substituent. This compound features a heptanone backbone, indicating it has a seven-carbon chain with a carbonyl group (C=O) at the first position. The presence of a 4-methoxyphenyl group suggests that there is a methoxy (-OCH3) substituent attached to a phenyl ring at the first carbon of the heptanone chain, which can influence its chemical reactivity and physical properties. The chlorine atom introduces additional polarity and can affect the compound's solubility and interaction with biological systems. Typically, compounds like this may exhibit various biological activities, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular structure and interactions, but detailed experimental data would be necessary for precise values.
Formula:C14H19ClO2
InChI:InChI=1S/C14H19ClO2/c1-17-13-9-7-12(8-10-13)14(16)6-4-2-3-5-11-15/h7-10H,2-6,11H2,1H3
InChI key:InChIKey=AUSYFSSBPKYNFN-UHFFFAOYSA-N
SMILES:C(CCCCCCCl)(=O)C1=CC=C(OC)C=C1
Synonyms:
  • 1-Heptanone, 7-chloro-1-(4-methoxyphenyl)-
  • 7-Chloro-1-(4-methoxyphenyl)-1-heptanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.